Product Overview
Epimagnolin B | TN1009 | TargetMol Chemicals
CAS: 1134188-26-3
Smiles: [H][C@@]12CO[C@H](c3cc(OC)c(OC)c(OC)c3)[C@]1([H])CO[C@H]2c1cc(OC)cc(OC)c1
Formula: C23H28O7
Pathway: GPCR/G Protein|||Immunology/Inflammation|||NF-Κb
Target: NF-κB|||NO Synthase|||Prostaglandin Receptor
Receptor: N/A
Bioactivity: Epimagnolin B has anti-inflammatory activity, it can inhibit the production of NO and PGE(2) and the expression of respective enzyme iNOS and COX-2 through the suppression of I-kappaB-alpha degradation and nuclear translocation of p65 subunit of NF-kappaB. It also exhibits antiallergic effects without affecting the viability of bone marrow-derived mast cells.
Molecular Weight: 416, 47
