Epimedokoreanin B | TN3972

Epimedokoreanin B | TN3972 | TargetMol Chemicals

CAS: 161068-53-7

Smiles: CC(C)=CCc1cc(cc(O)c1O)-c1cc(=O)c2c(O)cc(O)c(CC=C(C)C)c2o1

Formula: C25H26O6

Pathway: Others

Target: Others

Receptor: N/A

Bioactivity: Epimedokoreanin B shows scavenge the DPPH radical activity, it can inhibit the proliferation of MCF-7 and HepG2 in dose-dependant manner. Epimedokoreanin B can significantly inhibit the formation of both N (ε) -(carboxymethyl)lysine (CML) and N (ω) -(carboxymethyl)arginine (CMA), it may prevent clinical complications of diabetes by inhibiting advanced glycation end-products (AGEs).

Molecular Weight: 422, 5