Product Overview
Eriocalyxin B | TN1620 | TargetMol Chemicals
CAS: 84745-95-9
Smiles: [H][C@@]12CC[C@@H]3C[C@]1(C(=O)C3=C)[C@@]1(O)OC[C@]22C(=O)C=CC(C)(C)[C@@]2([H])[C@@H]1O
Formula: C20H24O5
Pathway: Apoptosis|||GPCR/G Protein|||JAK/STAT signaling|||NF-Κb|||Stem Cells
Target: Apoptosis|||cAMP|||NF-κB|||STAT
Receptor: N/A
Bioactivity: Eriocalyxin B induces apoptosis and cell cycle arrest in pancreatic adenocarcinoma cells through caspase- and p53-dependent pathways, should be considered a candidate for pancreatic cancer treatment; it is a specific inhibitor of STAT3, it directly targets STAT3 through a covalent linkage to inhibit the phosphorylation and activation of STAT3 and induces apoptosis of STAT3-dependent tumor cells.
Molecular Weight: 344, 407
