Product Overview
Erythrosin B | T0578 | TargetMol Chemicals
CAS: 15905-32-5
Smiles: Oc1c(I)cc2c(Oc3c(I)c(O)c(I)cc3C22OC(=O)c3ccccc23)c1I
Formula: C20H8I4O5
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Iodeosin, a tetraiodofluorescein, is used as a red coloring in some foods (cherries, fish), as a stain of some cell types, and as a disclosure of DENTAL PLAQUE. Its molecular structure is similar to THYROXINE.
Molecular Weight: 835, 897
