Product Overview
Estriol | T1571 | TargetMol Chemicals
CAS: 50-27-1
Smiles: C[C@]12CC[C@H]3[C@@H](CCc4cc(O)ccc34)[C@@H]1C[C@@H](O)[C@@H]2O
Formula: C18H24O3
Pathway: Endocrinology/Hormones|||Immunology/Inflammation|||Metabolism
Target: Estrogen Receptor/ERR|||Estrogen/progestogen Receptor|||MRP|||Endogenous Metabolite
Receptor: N/A
Bioactivity: Estriol is a hydroxylated metabolite of ESTRADIOL or ESTRONE that has a hydroxyl group at C3, 16-alpha, and 17-beta position. Estriol is a major urinary estrogen. During PREGNANCY, a large amount of estriol is produced by the PLACENTA.
Molecular Weight: 288, 387
