Product Overview
Etoposide Phosphate | T21303 | TargetMol Chemicals
CAS: 117091-64-2
Smiles: O=P(O)(OC1=C(OC)C=C([C@H](C2=C3C=C4OCOC4=C2)[C@@]5([H])C(OC[C@]5([H])[C@@H]3O[C@H]6[C@H](O)[C@@H](O)[C@]7([H])O[C@H](C)OC[C@@]7([H])O6)=O)C=C1OC)O
Formula: C29H33O16P
Pathway: N/A
Target: N/A
Receptor: N/A
Bioactivity: Etoposide phosphate is a phosphate salt of Etoposide, which binds to the enzyme topoisomerase II, then induces double-strand DNA breaks and inhibits DNA repair, leading to decreased DNA synthesis and tumor cell proliferation.
Molecular Weight: 668, 54
