Product Overview
Euphorbia factor L1 | T2S0410 | TargetMol Chemicals
CAS: 76376-43-7
Smiles: C[C@H]1C[C@@]2(OC(C)=O)[C@H]([C@H]1OC(=O)Cc1ccccc1)[C@@H](OC(C)=O)[C@@]1(CO1)CC[C@H]1[C@@H](\C=C(C)\C2=O)C1(C)C
Formula: C32H40O8
Pathway: Apoptosis|||Membrane transporter/Ion channel|||Neuroscience
Target: Apoptosis|||P-gp
Receptor: N/A
Bioactivity: 1. Euphorbia factor L1 can enhance the ATP hydrolysis activity of ABCB1 stimulated by verapamil. 2. Euphorbia factor L1 inhibits the efflux of ABCB1 in KBv200 and MCF-7/adr cells, does not downregulate their expression either in mRNA or protein level.
Molecular Weight: 552, 664
