Product Overview
Fargesin | T5S2178 | TargetMol Chemicals
CAS: 31008-19-2
Smiles: COc1ccc(cc1OC)[C@@H]1OC[C@H]2[C@@H]1CO[C@@H]2c1ccc2OCOc2c1
Formula: C21H22O6
Pathway: GPCR/G Protein|||Neuroscience
Target: Adrenergic Receptor
Receptor: N/A
Bioactivity: 1. Fargesin as a potential β1AR antagonist through cAMP/PKA pathway could protect against myocardial ischemia/reperfusion injury in rats. 2. Fargesin improves dyslipidemia and hyperglycemia by activating Akt and AMPK in WAT.
Molecular Weight: 370, 401
