Product Overview
Fatostatin | T9266 | TargetMol Chemicals
CAS: 125256-00-0
Smiles: CCCC1=NC=CC(C2=NC(C3=CC=C(C)C=C3)=CS2)=C1
Formula: C18H18N2S
Pathway: Metabolism
Target: Lipid|||Fatty Acid Synthase
Receptor: N/A
Bioactivity: Fatostatin is a specific inhibitor of SREBP activation, it impairs the activation of SREBP-1 and SREBP-2. Fatostatin binds to SCAP (SREBP cleavage-activating protein), and inhibits the ER-Golgi translocation of SREBPs.
Molecular Weight: 294, 41
