Product Overview
Fexofenadine | T21390 | TargetMol Chemicals
CAS: 83799-24-0
Smiles: CC(C)(C(O)=O)c1ccc(cc1)C(O)CCCN1CCC(CC1)C(O)(c1ccccc1)c1ccccc1
Formula: C32H39NO4
Pathway: GPCR/G Protein|||Immunology/Inflammation|||Neuroscience
Target: Histamine Receptor
Receptor: N/A
Bioactivity: Fexofenadine, an antihistamine pharmaceutical drug, is used to treat allergy symptoms, such as nasal congestion, hay fever, and urticaria. Compared to first-generation antihistamines, Fexofenadine is less able to pass the blood-brain barrier and cause sedation.
Molecular Weight: 501, 667
