Product Overview
FIPI | T3580 | TargetMol Chemicals
CAS: 939055-18-2
Smiles: Fc1ccc2[nH]c(cc2c1)C(=O)NCCN1CCC(CC1)n1c2ccccc2[nH]c1=O
Formula: C23H24FN5O2
Pathway: Autophagy|||Metabolism
Target: Phospholipase|||Autophagy
Receptor: N/A
Bioactivity: FIPI is a derivative of halopemide which potently inhibits both PLD1 (IC50 = 25 nM) and PLD2 (IC50 = 20 nM); prevents PLD regulation of F-actin cytoskeleton reorganization, cell spreading, and chemotaxis.
Molecular Weight: 421, 476
