Product Overview
FK-739 free acid | T27325 | TargetMol Chemicals
CAS: 133052-30-9
Smiles: CCCCc1nc2cccnc2n1Cc1ccc(cc1)-c1ccccc1-c1nn[nH]n1
Formula: C24H23N7
Pathway: N/A
Target: N/A
Receptor: N/A
Bioactivity: FK-739 is an angiotensin type 1 receptor antagonist. FK 739 inhibits the specific binding of [125I]-angiotensin II to rat aortic smooth muscle cell membrane (IC50 = 8.6 nM) without displacing the specific binding of [125I]-angiotensin II to bovine cerebellum membrane.
Molecular Weight: 409, 497
