Product Overview
Flavokawain B | T6S0735 | TargetMol Chemicals
CAS: 1775-97-9
Smiles: COc1cc(O)c(C(=O)\C=C\c2ccccc2)c(OC)c1
Formula: C17H16O4
Pathway: Apoptosis|||Others
Target: Apoptosis|||Others
Receptor: N/A
Bioactivity: 1. Flavokawain B has potent anti-inflammatory activity, can significantly inhibit production of NO and PGE2 in LPS-induced RAW 264.7 cells. 2. Flavokawain B, the hepatotoxic constituent from kava root, induces GSH-sensitive oxidative stress through modulation of IKK/NF-κB and MAPK signaling pathways. 3. Flavokawain B induces apoptosis, has the potential usefulness of FKB for prevention and treatment of hormone-refractory prostate cancer in an adjuvant setting. 4. Flavokawain B acts through ROS generation and GADD153 up-regulation to regulate the expression of Bcl-2 family members, thereby inducing mitochondrial dysfunction and apoptosis in HCT116 cells.
Molecular Weight: 284, 311
