Product Overview
Folcysteine | T25434 | TargetMol Chemicals
CAS: 8064-47-9
Smiles: N[C@@H](CS)C(O)=O.Nc1nc(=O)c2nc(CNc3ccc(cc3)C(=O)N[C@@H](CCC(O)=O)C(O)=O)cnc2[nH]1
Formula: C22H26N8O8S
Pathway: N/A
Target: N/A
Receptor: N/A
Bioactivity: Folcysteine is a cysteine derivative with potential antitumor agent. It's a vitamin that used to synthesize DNA, conduct DNA repair and methylate DNA. It also acts as a cofactor in biological reactions involving folate.
Molecular Weight: 562, 56