Product Overview
Ganoderic acid X | TN4107 | TargetMol Chemicals
CAS: 86377-53-9
Smiles: C[C@H](CC\C=C(/C)C(O)=O)C1C[C@H](OC(C)=O)[C@@]2(C)C3=CC[C@H]4C(C)(C)[C@H](O)CC[C@]4(C)C3=CC[C@]12C
Formula: C32H48O5
Pathway: Apoptosis|||DNA Damage/DNA Repair|||MAPK|||Proteases/Proteasome
Target: ERK|||Mdm2|||MAPK|||Caspase|||Topoisomerase|||JNK|||p53
Receptor: N/A
Bioactivity: Ganoderic acid X is a potential Mdm2 inhibitor(K(i) = 16nM). It is a potential anticancer drug, inhibits topoisomerases and induces apoptosis of cancer cells.
Molecular Weight: 512, 72
