Product Overview
Gemcitabine elaidate hydrochloride | T15378L | TargetMol Chemicals
CAS: T15378L
Smiles: O[C@@H](C(F)(F)[C@H](N1C(N=C(C=C1)N)=O)O2)[C@H]2COC(CCCCCCC/C=C/CCCCCCCC)=O.Cl
Formula: C27H44ClF2N3O5
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Gemcitabine elaidate hydrochloride is a lipophilic and unsaturated fatty acid ester derivative of gemcitabine (dFdC). Gemcitabine elaidate is also an antimetabolite deoxynucleoside analogue. It has a potential antineoplastic activity.
Molecular Weight: 564, 11
 
             
             
                    
            
            
            
           