Product Overview
Genkwanin | T6S0095 | TargetMol Chemicals
CAS: 437-64-9
Smiles: COc1cc(O)c2c(c1)oc(cc2=O)-c1ccc(O)cc1
Formula: C16H12O5
Pathway: Microbiology/Virology
Target: Virus Protease
Receptor: N/A
Bioactivity: 1. Genkwanin exerts its anti-inflammatory effect mainly through the regulation of the miR-11/MKP-1/MAPK pathway. 2. Genkwanin is transported by both passive diffusion and multidrug resistance protein (MDR)-mediated efflux mechanisms.
Molecular Weight: 284, 267