Product Overview
Ginsenoside Rk3 | T6S1495 | TargetMol Chemicals
CAS: 364779-15-7
Smiles: CC(C)=CCCC(=C)[C@H]1CC[C@]2(C)[C@@H]1[C@H](O)C[C@@H]1[C@@]3(C)CC[C@H](O)C(C)(C)[C@@H]3[C@H](C[C@@]21C)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O
Formula: C36H60O8
Pathway: NF-Κb|||Others
Target: Others|||NF-κB
Receptor: N/A
Bioactivity: 1. Ginsenoside Rk3 and Rh4 could have a role in treating inflammatory diseases. 2. Ginsenoside Rk3 is often used as a major ingredient of the compound preparation for ischemic heart diseases.
Molecular Weight: 620, 868
