Product Overview
Glaucocalyxin A | T4S0498 | TargetMol Chemicals
CAS: 79498-31-0
Smiles: CC1(C)[C@H]2C[C@@H](O)[C@@]34[C@H](O)[C@@H](CC[C@H]3[C@]2(C)CCC1=O)C(=C)C4=O
Formula: C20H28O4
Pathway: Apoptosis|||Cytoskeletal Signaling|||PI3K/Akt/mTOR signaling|||Proteases/Proteasome
Target: Apoptosis|||Akt|||Caspase|||PI3K
Receptor: N/A
Bioactivity: 1. Glaucocalyxin A-SBE-β-CD could be useful with a better solubility and sustained function in drug delivery. 2. Glaucocalyxin A activates caspase-3, decreases BAD phosphorylation, and reduces the expression of X-linked inhibitor of apoptosis protein. 3. Glaucocalyxin A inhibits Akt phosphorylation, suppresses proliferation, and promotes apoptosis in a dose-dependent manner, but not in normal glial cells. 4. Glaucocalyxin A inhibits collagen-stimulated tyrosine phosphorylation of Syk, LAT, and phospholipase Cγ2, the signaling events in collagen receptor GPⅥ pathway. 5. Glaucocalyxin A could potentially be developed as an antiplatelet and antithrombotic agent, can inhibit platelet p-selectin secretion and integrin activation by convulxin, is a GPVI selective ligand.
Molecular Weight: 332, 44
