Product Overview
Glycoprotein B (485-492) | T22800 | TargetMol Chemicals
CAS: T22800
Smiles: NC(CO)C(NC(CO)C(NC(C(CC)C)C(NC(CCC(O)=O)C(NC(CC1=CC=CC=C1)C(NC(C)C(NC(CCCNC(N)=N)C(NC(CC(C)C)C(O)=O)=O)=O)=O)=O)=O)=O)=O
Formula: C41H67N11O13
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Glycoprotein B is a peptide with the sequence H2N-Ser-Ser-Ile-Glu-Phe-Ala-Arg-Leu-OH, MW= 922.04. glycoprotein B is a viral glycoprotein that is involved in the viral cell entry of Herpes simplex virus. The herpesvirus glycoprotein B is the most highly conserved of all surface glycoproteins and acts primarily as a fusion protein [1][2][3].
Molecular Weight: 922, 04
