Product Overview
GPNA hydrochloride | T15411 | TargetMol Chemicals
CAS: 67953-08-6
Smiles: Cl.N[C@@H](CCC(=O)Nc1ccc(cc1)[N+]([O-])=O)C(O)=O
Formula: C11H14ClN3O5
Pathway: Apoptosis|||Others
Target: Apoptosis|||Others
Receptor: N/A
Bioactivity: GPNA hydrochloride is specific glutamine (Gln) transporter ASCT2(SLC1A5) inhibitor. GPNA reversibly induces apoptosis in A549 cells. GPNA hydrochloride is a well-known substrate of the enzyme γ-glutamyltransferase (GGT). GPNA hydrochloride also inhibits Na+-dependent carriers, such as SNAT family (SNAT1/2/4/5), and the Na+-independent leucine transporters LAT1/2.
Molecular Weight: 303, 7
