Product Overview
GPR183 | T9975 | TargetMol Chemicals
CAS: 1241280-25-0
Smiles: Fc1cc(NC(=O)CCc2ccc(F)c(F)c2)cc(c1)N1CCOCC1
Formula: C19H19F3N2O2
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: GPR183 is a chemotactic receptor known for its role in the maturation of B cells, and the endogenous ligand is the oxysterol 7α, 25-dihydroxycholesterol (7α, 25-OHC). GPR183 can be used in research on inflammatory bowel disease (IBD).
Molecular Weight: 364, 368