Product Overview
Gracillin | T3774 | TargetMol Chemicals
CAS: 19083-00-2
Smiles: C[C@H]1[C@H]2[C@H](C[C@H]3[C@@H]4CC=C5C[C@H](CC[C@]5(C)[C@H]4CC[C@]23C)O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H]2O[C@@H]2O[C@@H](C)[C@H](O)[C@@H](O)[C@H]2O)O[C@]11CC[C@@H](C)CO1
Formula: C45H72O17
Pathway: Cell Cycle/Checkpoint
Target: cell cycle arrest
Receptor: N/A
Bioactivity: Gracillin can induce cell cycle arrest, oxidative stress, and apoptosis in HL60 cells, and has the potential to be developed as an antitumor agent. Gracillin can be selected as lead compounds for the development of new drugs against I. multifiliis.
Molecular Weight: 885, 054
