Product Overview
GSK J4 HCl (1373423-53-0 free base) | T22819 | TargetMol Chemicals
CAS: T22819
Smiles: CCOC(=O)CCNC1=NC(=NC(=C1)N2CCC3=CC=CC=C3CC2)C4=CC=CC=N4.Cl
Formula: C24H27N5O2·HCl
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: GSK J4 is an ethyl ester derivative of GSK J1, which is a potent JMJD3 inhibitor (IC50: 60 nM) with restricted cellular permeability due to the highly polar carboxylate group, and rapidly hydrolyzed by macrophage esterase upon administration leading to the generation of pharmacologically relevant intracellular concentration of GSK-J1.
Molecular Weight: 453, 96
