Product Overview
GSK4112 | T5045 | TargetMol Chemicals
CAS: 1216744-19-2
Smiles: CC(C)(C)OC(=O)CN(Cc1ccc(s1)[N+]([O-])=O)Cc1ccc(Cl)cc1
Formula: C18H21ClN2O4S
Pathway: Autophagy
Target: Autophagy
Receptor: N/A
Bioactivity: GSK4112 is a Rev-erbα agonist with EC50 of 0.4 μM, also is a small molecule chemical probe for the cell biology of the nuclear heme receptor Rev-erbα.
Molecular Weight: 396, 89