Product Overview
Harpagoside | T6S2023 | TargetMol Chemicals
CAS: 19210-12-9
Smiles: C[C@@]1(C[C@@H](O)[C@]2(O)C=CO[C@@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H]12)OC(=O)\C=C\c1ccccc1
Formula: C24H30O11
Pathway: Immunology/Inflammation|||Neuroscience|||Others
Target: Others|||COX|||NO Synthase
Receptor: N/A
Bioactivity: 1. Harpagoside has anti-inflammatory activity. 2. Harpagoside at 3 mM concentration, shows moderate inhibition of seed germination. 3. Harpagoside can inhibit lipopolysaccharide-induced mRNA levels and protein expression of cyclooxygenase-2 and inducible nitric oxide in HepG2 cells.
Molecular Weight: 494, 493
