HBcAg [Hepatitis B virus] (18-27) | TP2231

HBcAg [Hepatitis B virus] (18-27) | TP2231 | TargetMol Chemicals

CAS: TP2231

Smiles: N[C@H](C(N[C@H](C(N1[C@@H](CCC1)C(N[C@@H](CO)C(N[C@H](C(N[C@@H](CC2=CC=CC=C2)C(N[C@@H](CC3=CC=CC=C3)C(N4[C@@H](CCC4)C(N[C@H](C(N[C@H](C(O)=O)C(C)C)=O)CO)=O)=O)=O)=O)CC(O)=O)=O)=O)=O)CC(C)C)=O)CC5=CC=CC=C5

Formula: C58H78N10O15

Pathway: Others

Target: Others

Receptor: N/A

Bioactivity: HBcAg (core antigen) is a hepatitis B viral protein. It is an indicator of active viral replication; this means the person infected with Hepatitis B can likely transmit the virus on to another person.

Molecular Weight: 1155, 3