Product Overview
Heterophyllin B | T4S1796 | TargetMol Chemicals
CAS: 145459-19-4
Smiles: CC[C@H](C)[C@@H]1NC(=O)[C@@H]2CCCN2C(=O)[C@@H]2CCCN2C(=O)[C@@H]2CCCN2C(=O)[C@H](CC(C)C)NC(=O)CNC(=O)CNC(=O)[C@H](Cc2ccccc2)NC1=O
Formula: C40H58N8O8
Pathway: PI3K/Akt/mTOR signaling
Target: PI3K
Receptor: N/A
Bioactivity: Heterophyllin B effectively suppresses the adhesion and invasion of the human esophageal carcinoma cells by mediating the PI3K/AKT/β-catenin pathways and regulating the expression levels of adhesion- and invasion-associated genes.
Molecular Weight: 778, 952