Product Overview
Huperzine B | T2S1720 | TargetMol Chemicals
CAS: 103548-82-9
Smiles: CC1=C[C@H]2Cc3[nH]c(=O)ccc3[C@]3(C1)NCCC[C@H]23
Formula: C16H20N2O
Pathway: Neuroscience
Target: AChE
Receptor: N/A
Bioactivity: 1. Huperzine-B is a efficient inhibitor of human brain AChE. 2. Huperzine-B can enhance ognitive and protect neuro, may be potentially new drug candidates for Alzheimer's disease therapy.
Molecular Weight: 256, 349
