Product Overview
HYPOCRELLIN B | T5780 | TargetMol Chemicals
CAS: 123940-54-5
Smiles: COc1cc(O)c2c3c1c1c(OC)cc(O)c4c1c1c(c(OC)c4=O)C(C(C)=O)=C(C)Cc(c(OC)c2=O)c31
Formula: C30H24O9
Pathway: Apoptosis|||Microbiology/Virology
Target: Apoptosis|||Parasite|||Antifungal
Receptor: N/A
Bioactivity: HYPOCRELLIN B are photosensitive pigments isolated from Hypocrella bambusae Sacc. Hypocrellin B causes DNA strand breakage, induces apoptosis in ovarian cancer cells, and inhibits proliferation of Staphylococcus by increasing ROS levels, and damaging cell walls.
Molecular Weight: 528, 513
