Product Overview
IDH889 | T15551 | TargetMol Chemicals
CAS: 1429179-07-6
Smiles: CC(C)[C@H]1COC(=O)N1c1ccnc(N[C@@H](C)c2ncc(cn2)-c2ccc(F)c(C)c2)n1
Formula: C23H25FN6O2
Pathway: Metabolism|||Others
Target: Others|||Dehydrogenase
Receptor: N/A
Bioactivity: IDH889 is a brain penetrant, an allosteric and mutant specific IDH1 inhibitor. IDH889 has effective selectivity for IDH1 R132* mutations (IC50s: 0.02 μM, 0.072 μM, and 1.38 μM for IDH1R132H, IDH1R132C, and IDH1wt).
Molecular Weight: 436, 491