Product Overview
Imazamox | T15562 | TargetMol Chemicals
CAS: 114311-32-9
Smiles: COCc1cnc(C2=NC(C)(C(C)C)C(=O)N2)c(c1)C(O)=O
Formula: C15H19N3O4
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Imazamox is a systemic herbicide with high selectivity, high activity, safety and broadspectrum activity. Imazamox inhibits the production of acetolactate synthase (ALS) in plants, which would then inhibit plant growth and ultimately lead to plant death.
Molecular Weight: 305, 334