Product Overview
Inarigivir ammonium | T9518 | TargetMol Chemicals
CAS: 2172788-92-8
Smiles: NC1=C(N=CN2[C@@H]3O[C@H](COP(O[C@H]4[C@@H](OC)[C@H](N5C=CC(NC5=O)=O)O[C@@H]4CO)(S)=O)[C@@H](O)C3)C2=NC=N1.N
Formula: C20H29N8O10PS
Pathway: Microbiology/Virology
Target: HBV
Receptor: N/A
Bioactivity: Inarigivir ammonium is a dinucleotide antiviral compound that significantly reduces HBV DNA in transgenic mice expressing hepatitis B virus. Inarigivir is an agonist of retinoic acid-inducible gene-I (RIG-I) that activates intracellular innate immunity.
Molecular Weight: 604, 53
