Product Overview
Incensole | TWS1563 | TargetMol Chemicals
CAS: 22419-74-5
Smiles: CC(C)[C@]12CC[C@@](C)(O1)[C@H](O)CC\C(C)=C/CC\C(C)=C/C2
Formula: C20H34O2
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: 1. Incensole has a protective or stimulating effect on β-cells of the rat pancreas, it also can increase the insulin secretion, which evidenced by a significant increase both in body weight and in liver glycogen.
Molecular Weight: 306, 49
