Product Overview
INI-43 | T27612 | TargetMol Chemicals
CAS: 881046-01-1
Smiles: CN(C)CCCn1c(N)c(-c2nc3ccccc3[nH]2)c2nc3ccccc3nc12
Formula: C22H23N7
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: INI-43, an inhibitor of Nuclear Import-43, shows a significant cytotoxic effect on various cervical and oesophageal cancer cell lines by targeting Kpnβ1 and interferes with the nuclear localization of Kpnβ1 and known Kpnβ1 cargoes, NFAT, NFκB, AP-1 and NF
Molecular Weight: 385, 475
