Product Overview
Iriflophenone 2-O-Rhamnoside | TN3870 | TargetMol Chemicals
CAS: 943989-68-2
Smiles: C[C@@H]1O[C@@H](Oc2cc(O)cc(O)c2C(=O)c2ccc(O)cc2)[C@H](O)[C@H](O)[C@H]1O
Formula: C19H20O9
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Iriflophenone 2-O-Rhamnoside can reduce the amount of Immunoglobulin E (IgE) secreted by human myeloma U266 cells, it has potential as an anti-allergic agent. Iriflophenone 2-O-Rhamnoside also exhibits significant cytotoxicity against three human tumor cells(A-549 lung carcinoma, MCF-7 breast adenocarcinoma and HT-29 colon adenocarcinoma ).
Molecular Weight: 392, 4
