Product Overview
Isocorynoxeine | T6S0654 | TargetMol Chemicals
CAS: 51014-29-0
Smiles: CO\C=C(/[C@H]1C[C@@H]2N(CC[C@@]22C(=O)Nc3ccccc23)C[C@@H]1C=C)C(=O)OC
Formula: C22H26N2O4
Pathway: GPCR/G Protein|||Neuroscience
Target: 5-HT Receptor
Receptor: N/A
Bioactivity: 1. Isocorynoxeine shows the effects of lowering blood pressure, vasodilatation, and protection against ischemia-induced neuronal damage. 2. Isocorynoxeine exhibits a significant neuroprotective effect against glutamate-induced HT22 cell death at the maximum concentration.
Molecular Weight: 382, 46
