Product Overview
Isoliensinine | T5S1103 | TargetMol Chemicals
CAS: 6817-41-0
Smiles: COc1ccc(C[C@H]2N(C)CCc3cc(OC)c(Oc4cc(C[C@H]5N(C)CCc6cc(OC)c(O)cc56)ccc4O)cc23)cc1
Formula: C37H42N2O6
Pathway: Apoptosis|||oxidation-reduction
Target: Apoptosis|||Antioxidant
Receptor: N/A
Bioactivity: 1. Isoliensinine, a natural phenolic bisbenzyltetrahydroisoquinoline alkaloid, has received considerable attention for its potential biological effects such as antioxidant and anti-HIV activities. 2. Isoliensinine possesses an anti-proliferative effect, which is related to the decrease of the overexpression of growth factors PDGF-beta, bFGF, proto-oncogene c-fos, c-myc and hsp7.
Molecular Weight: 610, 751
