Product Overview
Isoquercetin | T5S0754 | TargetMol Chemicals
CAS: 482-35-9
Smiles: OC[C@H]1O[C@@H](Oc2c(oc3cc(O)cc(O)c3c2=O)-c2ccc(O)c(O)c2)[C@H](O)[C@@H](O)[C@@H]1O
Formula: C21H20O12
Pathway: Cytoskeletal Signaling|||Immunology/Inflammation|||NF-Κb|||Stem Cells
Target: NF-κB|||Wnt/beta-catenin|||NO Synthase
Receptor: N/A
Bioactivity: 1. Isoquercitrin is a potential stimulator of bone mineralization used for prophylaxis of osteoporotic disorders. 2. Isoquercitrin may be as a potential therapeutic agent against neurodegeneration in Parkinson's disease. 3. Isoquercitrin is an inhibitor of Wnt/β-catenin and may be as a potential novel anti-tumoral agent, such as against human pancreati、 liver cancer related to opioid receptors and to the activation of the mitogen-activated protein kinase (MAPK) signalling pathway. .
Molecular Weight: 464, 37
