Product Overview
Isorhynchophylline | T6S0657 | TargetMol Chemicals
CAS: 6859-01-4
Smiles: CC[C@H]1CN2CC[C@]3([C@@H]2C[C@@H]1\C(=C/OC)C(=O)OC)C(=O)Nc1ccccc31
Formula: C22H28N2O4
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: 1. Isorhyncophylline and rhyncophylline can directly inhibit the contractile responses induced by several agonists in small blood vessels of rat, they also can inhibit the hypertensive effect of angiotensin â…¡.
Molecular Weight: 384, 476