Product Overview
Isosakuranetin | T5S0229 | TargetMol Chemicals
CAS: 480-43-3
Smiles: COc1ccc(cc1)[C@@H]1CC(=O)c2c(O)cc(O)cc2O1
Formula: C16H14O5
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: 1. Isosakuranetin has cytotoxic and fungicide properties. 2. Isosakuranetin produces significant decrease in blood pressure. 3. Isosakuranetin significantly reduces the sensitivity of mice to noxious heat and PregS-induced chemical pain.
Molecular Weight: 286, 28