Product Overview
Isosulfan blue | T15598 | TargetMol Chemicals
CAS: 68238-36-8
Smiles: [Na+].CCN(CC)c1ccc(cc1)C(=C1C=CC(C=C1)=[N+](CC)CC)c1cc(ccc1S([O-])(=O)=O)S([O-])(=O)=O
Formula: C27H31N2NaO6S2
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Isosulfan blue is a blue dye for the identification of lymph vessels during lymphangiography and is possible to have an allergic reaction during breast cancer operations. Isosulfan blueis is used during sentinel lymph node biopsies in breast cancer.
Molecular Weight: 566, 66
