Product Overview
Isotretinoin | T1611 | TargetMol Chemicals
CAS: 4759-48-2
Smiles: C\C(\C=C\C1=C(C)CCCC1(C)C)=C/C=C/C(/C)=C\C(O)=O
Formula: C20H28O2
Pathway: Autophagy|||Metabolism
Target: Retinoid Receptor|||Endogenous Metabolite|||Autophagy
Receptor: N/A
Bioactivity: Isotretinoin binds to and activates nuclear retinoic acid receptors (RARs); activated RARs serve as transcription factors that promote cell differentiation and apoptosis. Isotretinoin is a naturally-occurring retinoic acid with potential antineoplastic activity. This agent also exhibits immunomodulatory and anti-inflammatory responses and inhibits ornithine decarboxylase, thereby decreasing polyamine synthesis and keratinization.
Molecular Weight: 300, 442
