Product Overview
Kuwanon B | TN2445 | TargetMol Chemicals
CAS: 62949-78-4
Smiles: CC(C)=CCc1c(oc2cc(O)cc(O)c2c1=O)-c1ccc2OC(C)(C)C=Cc2c1O
Formula: C25H24O6
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Kuwanon B belongs to the class of organic compounds known as 3-prenylated flavones. Within the cell, kuwanon B is primarily located in the membrane (predicted from logP). Outside of the human body, kuwanon b can be found in fruits. This makes kuwanon b a potential biomarker for the consumption of this food product.
Molecular Weight: 420, 461
