Product Overview
L-Arginine | T3S0364 | TargetMol Chemicals
CAS: 74-79-3
Smiles: N[C@@H](CCCNC(N)=N)C(O)=O
Formula: C6H14N4O2
Pathway: Immunology/Inflammation|||Metabolism
Target: IL Receptor|||Endogenous Metabolite|||NO Synthase
Receptor: N/A
Bioactivity: 1. L-Arginine exhibits anti-atherosclerotic effect. 2. L-Arginine and soy enriched diet are effective in prevention of osteoporosis associated with diabetes mellitus. 3. Exogenous L-Arginine could enhance neonate lymphocyte proliferation through an interleukin-2-independent pathway. 4. A combination of oral L-citrulline and L-Arginine effectively and rapidly augments NO-dependent responses at the acute stage.
Molecular Weight: 174, 204
