Product Overview
L-Cysteine hydrochloride hydrate | TN5283 | TargetMol Chemicals
CAS: 7048-04-6
Smiles: N[C@@H](CS)C(O)=O.[H]Cl.[H]O[H]
Formula: C3H10ClNO3S
Pathway: Metabolism|||Others
Target: Others|||Endogenous Metabolite
Receptor: N/A
Bioactivity: L-Cysteine hydrochloride hydrate is a conditionally essential amino acid, which acts as a precursor for biologically active molecules such as hydrogen sulphide (H2S), glutathione and taurine. L-Cysteine hydrochloride hydrate suppresses ghrelin and reduces appetite in rodents and humans.
Molecular Weight: 175, 64
