Product Overview
L-Tyrosine | T0493 | TargetMol Chemicals
CAS: 60-18-4
Smiles: C(=O)([C@@H](N)Cc1ccc(O)cc1)O
Formula: C9H11NO3
Pathway: Metabolism
Target: Amino Acids and Derivatives|||Endogenous Metabolite
Receptor: N/A
Bioactivity: L-tyrosine is a naturally occurring tyrosine and is synthesized in vivo from L-phenylalanine, considered a non-essential amino acid. L-Tyrosine is the levorotatory isomer of the aromatic amino acid tyrosine.
Molecular Weight: 181, 19
