Product Overview
Lappaol F | TN4411 | TargetMol Chemicals
CAS: 69394-17-8
Smiles: COc1cc(C[C@H]2COC(=O)[C@@H]2Cc2cc3[C@H](CO)[C@H](Oc3c(OC)c2)c2ccc(O)c(OC)c2)cc2[C@H](CO)[C@H](Oc12)c1ccc(O)c(OC)c1
Formula: C40H42O12
Pathway: Cell Cycle/Checkpoint|||MAPK|||Membrane transporter/Ion channel|||Neuroscience
Target: CDK|||P-gp|||JNK
Receptor: N/A
Bioactivity: 1. Lappaol F has antioxidant and antiaging properties, it may promote the C. elegans longevity and stress resistance through a JNK-1-DAF-16 cascade.
2. Lappaol F has potential chemosensitizing activity, it may be candidates for developing novel adjuvant anticancer agents.
3. Lappaol F exhibits antitumor activity in vitro and in vivo and has strong potential to be developed as an anticancer therapeutic.
4. Lappaol F strongly inhibited NO production in the LPS-stimulated RAW264.7 cells with the IC(50) value of 9.5 microM.
Molecular Weight: 714, 8
