Product Overview
Larotaxel | T15713 | TargetMol Chemicals
CAS: 156294-36-9
Smiles: [H][C@@]12C[C@@H]3C[C@@]33C(=O)[C@]([H])(OC(C)=O)C4=C(C)[C@@H](C[C@@](O)([C@@H](OC(=O)c5ccccc5)[C@]3([H])[C@@]1(CO2)OC(C)=O)C4(C)C)OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)c1ccccc1
Formula: C45H53NO14
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Larotaxel is a taxane analogue with preclinical activity against taxane-resistant breast cancer. It can cross the blood-brain barrier and has a much lower affinity for P-glycoprotein 1. Larotaxel promotes tubulin assembly and stabilizing microtubules, ultimately leading to cell death by apoptosis.
Molecular Weight: 831, 912
