Product Overview
Leptomycin B | T15735 | TargetMol Chemicals
CAS: 87081-35-4
Smiles: CC\C(\C=C\[C@@H]1OC(=O)C=C[C@@H]1C)=C\[C@H](C)C\C=C\C(\C)=C\[C@@H](C)C(=O)[C@@H](C)[C@H](O)[C@@H](C)C\C(C)=C\C(O)=O
Formula: C33H48O6
Pathway: Membrane transporter/Ion channel|||Microbiology/Virology
Target: CRM1|||Antibiotic|||Antifungal
Receptor: N/A
Bioactivity: Leptomycin B is a potent inhibitor of the nuclear export of proteins and is a potent antifungal antibiotic blocking the eukaryotic cell cycle. Leptomycin B inactivates CRM1/exportin 1 by covalent modification at a cysteine residue.
Molecular Weight: 540, 741
